About 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine
2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine (PubChem CID 70986915) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 70986915 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CCC1C=CCC(CC)N1C(C)(CC)CC |
| InChI | InChI=1S/C15H29N/c1-6-13-11-10-12-14(7-2)16(13)15(5,8-3)9-4/h10-11,13-14H,6-9,12H2,1-5H3 |
| InChIKey | FZCLDTUNPLZBEY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine (CID 70986915) is 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine is CCC1C=CCC(CC)N1C(C)(CC)CC.
What is the InChIKey of 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is FZCLDTUNPLZBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-6-13-11-10-12-14(7-2)16(13)15(5,8-3)9-4/h10-11,13-14H,6-9,12H2,1-5H3.
What are the key properties of 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine?
2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 223.40 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethyl-1-(3-methylpentan-3-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 70986915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).