C32H34N6 — CID 70987271
2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-7-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-5-ethyl-1H-imidazol-4-yl]phenyl]-4,5-dihydro-3H-benzo[e]benzimidazole (PubChem CID 70987271) has the molecular formula C32H34N6 and a molecular weight of 502.67 g/mol. Its IUPAC name is 2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-7-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-5-ethyl-1H-imidazol-4-yl]phenyl]-4,5-dihydro-3H-benzo[e]benzimidazole.
| Compound Name | 2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-7-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-5-ethyl-1H-imidazol-4-yl]phenyl]-4,5-dihydro-3H-benzo[e]benzimidazole |
|---|---|
| PubChem CID | 70987271 |
| Molecular Formula | C32H34N6 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-7-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-5-ethyl-1H-imidazol-4-yl]phenyl]-4,5-dihydro-3H-benzo[e]benzimidazole |
| SMILES | CCc1[nH]c([C@@H]2C[C@H]3C[C@H]3N2)nc1-c1ccc(-c2ccc3c(c2)CCc2[nH]c([C@@H]4C[C@H]5C[C@H]5N4)nc2-3)cc1 |
| InChI | InChI=1S/C32H34N6/c1-2-23-29(37-31(35-23)27-14-20-12-25(20)33-27)17-5-3-16(4-6-17)18-7-9-22-19(11-18)8-10-24-30(22)38-32(36-24)28-15-21-13-26(21)34-28/h3-7,9,11,20-21,25-28,33-34H,2,8,10,12-15H2,1H3,(H,35,37)(H,36,38)/t20-,21-,25-,26-,27+,28+/m1/s1 |
| InChIKey | VEUKJVSMSOLZBK-IKIOOZCCSA-N |
| XLogP | 5.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |