C31H59NO8 — CID 70987481
1-[(2S,3R,5S)-5-ethyl-3-hydroxy-2-[[(3S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxymethyl]pyrrolidin-1-yl]ethanone (PubChem CID 70987481) has the molecular formula C31H59NO8 and a molecular weight of 573.81 g/mol. Its IUPAC name is 1-[(2S,3R,5S)-5-ethyl-3-hydroxy-2-[[(3S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxymethyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(2S,3R,5S)-5-ethyl-3-hydroxy-2-[[(3S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxymethyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 70987481 |
| Molecular Formula | C31H59NO8 |
| Molecular Weight | 573.81 g/mol |
| Exact Mass | 573.42 |
| IUPAC Name | 1-[(2S,3R,5S)-5-ethyl-3-hydroxy-2-[[(3S)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]oxymethyl]pyrrolidin-1-yl]ethanone |
| SMILES | CCCCOCC1OC(OC[C@H]2[C@H](O)C[C@H](CC)N2C(C)=O)[C@@H](OCCCC)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C31H59NO8/c1-7-12-16-35-22-27-28(36-17-13-8-2)29(37-18-14-9-3)30(38-19-15-10-4)31(40-27)39-21-25-26(34)20-24(11-5)32(25)23(6)33/h24-31,34H,7-22H2,1-6H3/t24-,25-,26+,27?,28?,29?,30-,31?/m0/s1 |
| InChIKey | VAHGHCPEBFYJLR-LSADLTFVSA-N |
| XLogP | 4.86 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|