C24H24N4O3S — CID 70987526
3-pyridin-4-ylpropyl 2-benzamido-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 70987526) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 2-benzamido-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | 3-pyridin-4-ylpropyl 2-benzamido-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 70987526 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-pyridin-4-ylpropyl 2-benzamido-3-cyano-3,4,5,7-tetrahydro-2H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | N#CC1C2=C(CN(C(=O)OCCCc3ccncc3)CC2)SC1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N4O3S/c25-15-20-19-10-13-28(24(30)31-14-4-5-17-8-11-26-12-9-17)16-21(19)32-23(20)27-22(29)18-6-2-1-3-7-18/h1-3,6-9,11-12,20,23H,4-5,10,13-14,16H2,(H,27,29) |
| InChIKey | YFOUATBVBQQMKM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|