About 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol
2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol (PubChem CID 70987557) has the molecular formula C8H14N4O3
and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol |
| PubChem CID | 70987557 |
| Molecular Formula | C8H14N4O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol |
| SMILES | COc1nc(NCCO)nc(OC)c1N |
| InChI | InChI=1S/C8H14N4O3/c1-14-6-5(9)7(15-2)12-8(11-6)10-3-4-13/h13H,3-4,9H2,1-2H3,(H,10,11,12) |
| InChIKey | VZOJRGUKDDCEHA-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
The IUPAC name of 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol (CID 70987557) is 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol.
What is the SMILES notation for 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
The canonical SMILES for 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol is COc1nc(NCCO)nc(OC)c1N.
What is the InChIKey of 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
The InChIKey is VZOJRGUKDDCEHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O3/c1-14-6-5(9)7(15-2)12-8(11-6)10-3-4-13/h13H,3-4,9H2,1-2H3,(H,10,11,12).
What are the key properties of 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol?
2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol has a molecular weight of 214.22 g/mol, XLogP of -0.52, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-4,6-dimethoxypyrimidin-2-yl)amino]ethanol is sourced from PubChem (CID 70987557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).