About [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate
[2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 70988038) has the molecular formula C20H34O4
and a molecular weight of 338.49 g/mol. Its IUPAC name is [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| PubChem CID | 70988038 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC(C)(C)CC1(C(=O)OCC(=O)OC2(C)CCCCC2)CC1(C)C |
| InChI | InChI=1S/C20H34O4/c1-17(2,3)13-20(14-18(20,4)5)16(22)23-12-15(21)24-19(6)10-8-7-9-11-19/h7-14H2,1-6H3 |
| InChIKey | PAXZPXKRGVZUBP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate (CID 70988038) is [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate is CC(C)(C)CC1(C(=O)OCC(=O)OC2(C)CCCCC2)CC1(C)C.
What is the InChIKey of [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is PAXZPXKRGVZUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O4/c1-17(2,3)13-20(14-18(20,4)5)16(22)23-12-15(21)24-19(6)10-8-7-9-11-19/h7-14H2,1-6H3.
What are the key properties of [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate?
[2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 338.49 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-methylcyclohexyl)oxy-2-oxoethyl] 1-(2,2-dimethylpropyl)-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 70988038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).