C20H13FN4OS — CID 70988162
7-(4-fluoro-3-methylphenyl)-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 70988162) has the molecular formula C20H13FN4OS and a molecular weight of 376.42 g/mol. Its IUPAC name is 7-(4-fluoro-3-methylphenyl)-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 7-(4-fluoro-3-methylphenyl)-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 70988162 |
| Molecular Formula | C20H13FN4OS |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 7-(4-fluoro-3-methylphenyl)-3-phenyl-2-thia-5,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | Cc1cc(N2C(=O)Nc3c(-c4ccccc4)sc4ncnc2c34)ccc1F |
| InChI | InChI=1S/C20H13FN4OS/c1-11-9-13(7-8-14(11)21)25-18-15-16(24-20(25)26)17(12-5-3-2-4-6-12)27-19(15)23-10-22-18/h2-10H,1H3,(H,24,26) |
| InChIKey | XKEVWWBYRBLOEA-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |