C13H17ClN2 — CID 70988933
(3R,4S)-N-chloro-4-phenyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 70988933) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is (3R,4S)-N-chloro-4-phenyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | (3R,4S)-N-chloro-4-phenyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 70988933 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | (3R,4S)-N-chloro-4-phenyl-3-propyl-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CCC[C@H]1CN=C(NCl)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H17ClN2/c1-2-6-11-9-15-13(16-14)12(11)10-7-4-3-5-8-10/h3-5,7-8,11-12H,2,6,9H2,1H3,(H,15,16)/t11-,12+/m0/s1 |
| InChIKey | LAWAPVKJFVAQBV-NWDGAFQWSA-N |
| XLogP | 3.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|