About 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine
3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine (PubChem CID 70988985) has the molecular formula C13H21N3
and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine.
Molecular Properties
| Compound Name | 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine |
| PubChem CID | 70988985 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine |
| SMILES | CCC(CCNC)C1=NC2CC=CC=C2N1 |
| InChI | InChI=1S/C13H21N3/c1-3-10(8-9-14-2)13-15-11-6-4-5-7-12(11)16-13/h4-6,10,12,14H,3,7-9H2,1-2H3,(H,15,16) |
| InChIKey | NYFKAEHZNHPLNG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine?
The IUPAC name of 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine (CID 70988985) is 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine.
What is the SMILES notation for 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine?
The canonical SMILES for 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine is CCC(CCNC)C1=NC2CC=CC=C2N1.
What is the InChIKey of 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine?
The InChIKey is NYFKAEHZNHPLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3/c1-3-10(8-9-14-2)13-15-11-6-4-5-7-12(11)16-13/h4-6,10,12,14H,3,7-9H2,1-2H3,(H,15,16).
What are the key properties of 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine?
3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine has a molecular weight of 219.33 g/mol, XLogP of 1.84, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3a,4-dihydro-1H-benzimidazol-2-yl)-N-methylpentan-1-amine is sourced from PubChem (CID 70988985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).