About 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene
5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene (PubChem CID 70988991) has the molecular formula C19H19F3
and a molecular weight of 304.36 g/mol. Its IUPAC name is 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene.
Molecular Properties
| Compound Name | 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene |
| PubChem CID | 70988991 |
| Molecular Formula | C19H19F3 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene |
| SMILES | CC(C)(C)c1cc(F)c([C@H]2C[C@H]2c2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C19H19F3/c1-19(2,3)12-8-16(21)18(17(22)9-12)15-10-14(15)11-4-6-13(20)7-5-11/h4-9,14-15H,10H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | JADBEHYBYTUBNE-GJZGRUSLSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene?
The IUPAC name of 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene (CID 70988991) is 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene.
What is the SMILES notation for 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene?
The canonical SMILES for 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene is CC(C)(C)c1cc(F)c([C@H]2C[C@H]2c2ccc(F)cc2)c(F)c1.
What is the InChIKey of 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene?
The InChIKey is JADBEHYBYTUBNE-GJZGRUSLSA-N. The full InChI is InChI=1S/C19H19F3/c1-19(2,3)12-8-16(21)18(17(22)9-12)15-10-14(15)11-4-6-13(20)7-5-11/h4-9,14-15H,10H2,1-3H3/t14-,15-/m0/s1.
What are the key properties of 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene?
5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene has a molecular weight of 304.36 g/mol, XLogP of 5.67, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,3-difluoro-2-[(1S,2R)-2-(4-fluorophenyl)cyclopropyl]benzene is sourced from PubChem (CID 70988991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).