C26H31N7 — CID 70989369
8-N-(3-methylphenyl)-2-N-(3-phenylpropyl)-6-piperidin-1-yl-7H-purine-2,8-diamine (PubChem CID 70989369) has the molecular formula C26H31N7 and a molecular weight of 441.58 g/mol. Its IUPAC name is 8-N-(3-methylphenyl)-2-N-(3-phenylpropyl)-6-piperidin-1-yl-7H-purine-2,8-diamine.
| Compound Name | 8-N-(3-methylphenyl)-2-N-(3-phenylpropyl)-6-piperidin-1-yl-7H-purine-2,8-diamine |
|---|---|
| PubChem CID | 70989369 |
| Molecular Formula | C26H31N7 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 8-N-(3-methylphenyl)-2-N-(3-phenylpropyl)-6-piperidin-1-yl-7H-purine-2,8-diamine |
| SMILES | Cc1cccc(Nc2nc3nc(NCCCc4ccccc4)nc(N4CCCCC4)c3[nH]2)c1 |
| InChI | InChI=1S/C26H31N7/c1-19-10-8-14-21(18-19)28-26-29-22-23(31-26)30-25(32-24(22)33-16-6-3-7-17-33)27-15-9-13-20-11-4-2-5-12-20/h2,4-5,8,10-12,14,18H,3,6-7,9,13,15-17H2,1H3,(H3,27,28,29,30,31,32) |
| InChIKey | LRPUIRUEBVVIKB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|