C23H29N9O3 — CID 70989674
[7-[4-[bis(2-methoxyethyl)amino]phenyl]imino-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol (PubChem CID 70989674) has the molecular formula C23H29N9O3 and a molecular weight of 479.55 g/mol. Its IUPAC name is [7-[4-[bis(2-methoxyethyl)amino]phenyl]imino-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol.
| Compound Name | [7-[4-[bis(2-methoxyethyl)amino]phenyl]imino-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol |
|---|---|
| PubChem CID | 70989674 |
| Molecular Formula | C23H29N9O3 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | [7-[4-[bis(2-methoxyethyl)amino]phenyl]imino-3-pyrazin-2-ylpyrazolo[5,1-c][1,2,4]triazol-6-yl]-(dimethylamino)methanol |
| SMILES | COCCN(CCOC)c1ccc(/N=C2/C(C(O)N(C)C)=Nn3c2nnc3-c2cnccn2)cc1 |
| InChI | InChI=1S/C23H29N9O3/c1-30(2)23(33)20-19(22-28-27-21(32(22)29-20)18-15-24-9-10-25-18)26-16-5-7-17(8-6-16)31(11-13-34-3)12-14-35-4/h5-10,15,23,33H,11-14H2,1-4H3/b26-19- |
| InChIKey | GTNOHJRVURYKRY-XHPQRKPJSA-N |
| XLogP | 1.05 |
| TPSA | 126.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|