About 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene
3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene (PubChem CID 70989773) has the molecular formula C17H30S
and a molecular weight of 266.49 g/mol. Its IUPAC name is 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene |
| PubChem CID | 70989773 |
| Molecular Formula | C17H30S |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene |
| SMILES | CCC(C)C1(C)C=CC(SC(C)(C)CC)C(C)=C1 |
| InChI | InChI=1S/C17H30S/c1-8-14(4)17(7)11-10-15(13(3)12-17)18-16(5,6)9-2/h10-12,14-15H,8-9H2,1-7H3 |
| InChIKey | YRVFGTVOOONIGO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene?
The IUPAC name of 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene (CID 70989773) is 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene.
What is the SMILES notation for 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene?
The canonical SMILES for 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene is CCC(C)C1(C)C=CC(SC(C)(C)CC)C(C)=C1.
What is the InChIKey of 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene?
The InChIKey is YRVFGTVOOONIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30S/c1-8-14(4)17(7)11-10-15(13(3)12-17)18-16(5,6)9-2/h10-12,14-15H,8-9H2,1-7H3.
What are the key properties of 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene?
3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene has a molecular weight of 266.49 g/mol, XLogP of 5.85, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-1,3-dimethyl-6-(2-methylbutan-2-ylsulfanyl)cyclohexa-1,4-diene is sourced from PubChem (CID 70989773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).