C17H29N5O — CID 70989798
1-ethyl-1-[(4E)-4-(imidazolidin-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-3-methylurea (PubChem CID 70989798) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-ethyl-1-[(4E)-4-(imidazolidin-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-3-methylurea.
| Compound Name | 1-ethyl-1-[(4E)-4-(imidazolidin-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-3-methylurea |
|---|---|
| PubChem CID | 70989798 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 1-ethyl-1-[(4E)-4-(imidazolidin-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-3-methylurea |
| SMILES | CCN(C(=O)NC)C1=CCC2NCC/C(=C\C3CNCN3)C2C1 |
| InChI | InChI=1S/C17H29N5O/c1-3-22(17(23)18-2)14-4-5-16-15(9-14)12(6-7-20-16)8-13-10-19-11-21-13/h4,8,13,15-16,19-21H,3,5-7,9-11H2,1-2H3,(H,18,23)/b12-8+ |
| InChIKey | OKNYMHIFRVBWQH-XYOKQWHBSA-N |
| XLogP | 0.75 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|