C17H30N4O — CID 70989801
N-[(4E)-4-(2,3-diaminopropylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-ethylpropanamide (PubChem CID 70989801) has the molecular formula C17H30N4O and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[(4E)-4-(2,3-diaminopropylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-ethylpropanamide.
| Compound Name | N-[(4E)-4-(2,3-diaminopropylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 70989801 |
| Molecular Formula | C17H30N4O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | N-[(4E)-4-(2,3-diaminopropylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-N-ethylpropanamide |
| SMILES | CCC(=O)N(CC)C1=CCC2NCC/C(=C\C(N)CN)C2C1 |
| InChI | InChI=1S/C17H30N4O/c1-3-17(22)21(4-2)14-5-6-16-15(10-14)12(7-8-20-16)9-13(19)11-18/h5,9,13,15-16,20H,3-4,6-8,10-11,18-19H2,1-2H3/b12-9+ |
| InChIKey | YYMGOWZMFJQRAO-FMIVXFBMSA-N |
| XLogP | 1.11 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|