C16H25N5O — CID 70989828
1-[(4E)-4-(2,3-dihydro-1H-imidazol-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-1,3-dimethylurea (PubChem CID 70989828) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(4E)-4-(2,3-dihydro-1H-imidazol-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-1,3-dimethylurea.
| Compound Name | 1-[(4E)-4-(2,3-dihydro-1H-imidazol-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 70989828 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | 1-[(4E)-4-(2,3-dihydro-1H-imidazol-4-ylmethylidene)-2,3,4a,5,8,8a-hexahydro-1H-quinolin-6-yl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)C1=CCC2NCC/C(=C\C3=CNCN3)C2C1 |
| InChI | InChI=1S/C16H25N5O/c1-17-16(22)21(2)13-3-4-15-14(8-13)11(5-6-19-15)7-12-9-18-10-20-12/h3,7,9,14-15,18-20H,4-6,8,10H2,1-2H3,(H,17,22)/b11-7+ |
| InChIKey | IODFTQFZSXCIHJ-YRNVUSSQSA-N |
| XLogP | 0.83 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |