C19H37N5O3 — CID 70990408
(6R)-N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-6-[(4S,5R)-5-ethyl-2-oxoimidazolidin-4-yl]heptanamide (PubChem CID 70990408) has the molecular formula C19H37N5O3 and a molecular weight of 383.54 g/mol. Its IUPAC name is (6R)-N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-6-[(4S,5R)-5-ethyl-2-oxoimidazolidin-4-yl]heptanamide.
| Compound Name | (6R)-N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-6-[(4S,5R)-5-ethyl-2-oxoimidazolidin-4-yl]heptanamide |
|---|---|
| PubChem CID | 70990408 |
| Molecular Formula | C19H37N5O3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | (6R)-N-[(5S)-6-amino-5-(methylamino)-6-oxohexyl]-6-[(4S,5R)-5-ethyl-2-oxoimidazolidin-4-yl]heptanamide |
| SMILES | CC[C@H]1NC(=O)N[C@H]1[C@H](C)CCCCC(=O)NCCCC[C@H](NC)C(N)=O |
| InChI | InChI=1S/C19H37N5O3/c1-4-14-17(24-19(27)23-14)13(2)9-5-6-11-16(25)22-12-8-7-10-15(21-3)18(20)26/h13-15,17,21H,4-12H2,1-3H3,(H2,20,26)(H,22,25)(H2,23,24,27)/t13-,14-,15+,17+/m1/s1 |
| InChIKey | LLIWAHLIDUOORD-AIANPOQGSA-N |
| XLogP | 1.00 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|