C13H20O2 — CID 70990422
(1R,2S,4R)-6-methyl-8-propan-2-ylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid (PubChem CID 70990422) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,2S,4R)-6-methyl-8-propan-2-ylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,4R)-6-methyl-8-propan-2-ylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70990422 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,2S,4R)-6-methyl-8-propan-2-ylbicyclo[2.2.2]oct-5-ene-2-carboxylic acid |
| SMILES | CC1=C[C@@H]2C[C@H](C(=O)O)[C@H]1CC2C(C)C |
| InChI | InChI=1S/C13H20O2/c1-7(2)10-6-11-8(3)4-9(10)5-12(11)13(14)15/h4,7,9-12H,5-6H2,1-3H3,(H,14,15)/t9-,10?,11+,12+/m1/s1 |
| InChIKey | UPPCCJWKDIKFJH-VIVKNYSDSA-N |
| XLogP | 2.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|