About methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate
methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate (PubChem CID 70990451) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate |
| PubChem CID | 70990451 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate |
| SMILES | CCO[C@@]1(C(=O)OC)C=C[C@@H](O)C(O)C1 |
| InChI | InChI=1S/C10H16O5/c1-3-15-10(9(13)14-2)5-4-7(11)8(12)6-10/h4-5,7-8,11-12H,3,6H2,1-2H3/t7-,8?,10+/m1/s1 |
| InChIKey | HHWNOWGFHKMXEY-SHTILUHOSA-N |
| XLogP | -0.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate?
The IUPAC name of methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate (CID 70990451) is methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate.
What is the SMILES notation for methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate?
The canonical SMILES for methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate is CCO[C@@]1(C(=O)OC)C=C[C@@H](O)C(O)C1.
What is the InChIKey of methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate?
The InChIKey is HHWNOWGFHKMXEY-SHTILUHOSA-N. The full InChI is InChI=1S/C10H16O5/c1-3-15-10(9(13)14-2)5-4-7(11)8(12)6-10/h4-5,7-8,11-12H,3,6H2,1-2H3/t7-,8?,10+/m1/s1.
What are the key properties of methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate?
methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate has a molecular weight of 216.23 g/mol, XLogP of -0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R,4R)-1-ethoxy-4,5-dihydroxycyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 70990451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).