About 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole
2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole (PubChem CID 70990591) has the molecular formula C21H18F2N4O
and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole |
| PubChem CID | 70990591 |
| Molecular Formula | C21H18F2N4O |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole |
| SMILES | CCCCc1c(-c2nc(-c3ccccc3F)co2)nnn1-c1ccccc1F |
| InChI | InChI=1S/C21H18F2N4O/c1-2-3-11-19-20(25-26-27(19)18-12-7-6-10-16(18)23)21-24-17(13-28-21)14-8-4-5-9-15(14)22/h4-10,12-13H,2-3,11H2,1H3 |
| InChIKey | NUCQRHZJWLOXLR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole?
The IUPAC name of 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole (CID 70990591) is 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole.
What is the SMILES notation for 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole?
The canonical SMILES for 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole is CCCCc1c(-c2nc(-c3ccccc3F)co2)nnn1-c1ccccc1F.
What is the InChIKey of 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole?
The InChIKey is NUCQRHZJWLOXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N4O/c1-2-3-11-19-20(25-26-27(19)18-12-7-6-10-16(18)23)21-24-17(13-28-21)14-8-4-5-9-15(14)22/h4-10,12-13H,2-3,11H2,1H3.
What are the key properties of 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole?
2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole has a molecular weight of 380.40 g/mol, XLogP of 5.21, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-butyl-1-(2-fluorophenyl)triazol-4-yl]-4-(2-fluorophenyl)-1,3-oxazole is sourced from PubChem (CID 70990591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).