C16H27NO — CID 70990871
(E)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)dec-2-en-4-one (PubChem CID 70990871) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (E)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)dec-2-en-4-one.
| Compound Name | (E)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)dec-2-en-4-one |
|---|---|
| PubChem CID | 70990871 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (E)-1-(3,4,5,6-tetrahydro-2H-azepin-7-yl)dec-2-en-4-one |
| SMILES | CCCCCCC(=O)/C=C/CC1=NCCCCC1 |
| InChI | InChI=1S/C16H27NO/c1-2-3-4-7-12-16(18)13-9-11-15-10-6-5-8-14-17-15/h9,13H,2-8,10-12,14H2,1H3/b13-9+ |
| InChIKey | TZDZXVZKVRFHQD-UKTHLTGXSA-N |
| XLogP | 4.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|