About 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile
7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile (PubChem CID 70990908) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile.
Molecular Properties
| Compound Name | 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile |
| PubChem CID | 70990908 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile |
| SMILES | CC(C)(C)C12CC(C#N)CC3CC(C1)C3C2 |
| InChI | InChI=1S/C15H23N/c1-14(2,3)15-6-10(9-16)4-11-5-12(7-15)13(11)8-15/h10-13H,4-8H2,1-3H3 |
| InChIKey | SDDOXTHGJZJUMH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile?
The IUPAC name of 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile (CID 70990908) is 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile.
What is the SMILES notation for 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile?
The canonical SMILES for 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile is CC(C)(C)C12CC(C#N)CC3CC(C1)C3C2.
What is the InChIKey of 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile?
The InChIKey is SDDOXTHGJZJUMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N/c1-14(2,3)15-6-10(9-16)4-11-5-12(7-15)13(11)8-15/h10-13H,4-8H2,1-3H3.
What are the key properties of 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile?
7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile has a molecular weight of 217.36 g/mol, XLogP of 4.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyltricyclo[5.2.1.03,9]decane-5-carbonitrile is sourced from PubChem (CID 70990908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).