C12H19N3 — CID 70991342
N-(3,4-dihydropyridin-2-ylmethyl)-1-(1,2,3,6-tetrahydropyridin-6-yl)methanamine (PubChem CID 70991342) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N-(3,4-dihydropyridin-2-ylmethyl)-1-(1,2,3,6-tetrahydropyridin-6-yl)methanamine.
| Compound Name | N-(3,4-dihydropyridin-2-ylmethyl)-1-(1,2,3,6-tetrahydropyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 70991342 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-(3,4-dihydropyridin-2-ylmethyl)-1-(1,2,3,6-tetrahydropyridin-6-yl)methanamine |
| SMILES | C1=CC(CNCC2=NC=CCC2)NCC1 |
| InChI | InChI=1S/C12H19N3/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12/h1,4-5,8,11,13-14H,2-3,6-7,9-10H2 |
| InChIKey | IUOXZWJRVCZVGY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|