About 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine
2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 70991679) has the molecular formula C15H13F3N2
and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine |
| PubChem CID | 70991679 |
| Molecular Formula | C15H13F3N2 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | FC(F)(F)C1=CC=CN2CC(Cc3ccccc3)N=C12 |
| InChI | InChI=1S/C15H13F3N2/c16-15(17,18)13-7-4-8-20-10-12(19-14(13)20)9-11-5-2-1-3-6-11/h1-8,12H,9-10H2 |
| InChIKey | NXYHJRXYQBETJQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine?
The IUPAC name of 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine (CID 70991679) is 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine?
The canonical SMILES for 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine is FC(F)(F)C1=CC=CN2CC(Cc3ccccc3)N=C12.
What is the InChIKey of 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine?
The InChIKey is NXYHJRXYQBETJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2/c16-15(17,18)13-7-4-8-20-10-12(19-14(13)20)9-11-5-2-1-3-6-11/h1-8,12H,9-10H2.
What are the key properties of 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine?
2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine has a molecular weight of 278.28 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-8-(trifluoromethyl)-2,3-dihydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 70991679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).