About 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide
2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide (PubChem CID 70992054) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide.
Molecular Properties
| Compound Name | 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide |
| PubChem CID | 70992054 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide |
| SMILES | CC(=O)C1(C)OCC(C#N)(C(N)=O)CO1 |
| InChI | InChI=1S/C9H12N2O4/c1-6(12)8(2)14-4-9(3-10,5-15-8)7(11)13/h4-5H2,1-2H3,(H2,11,13) |
| InChIKey | JEQOHEICBWFMMI-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide?
The IUPAC name of 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide (CID 70992054) is 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide.
What is the SMILES notation for 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide?
The canonical SMILES for 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide is CC(=O)C1(C)OCC(C#N)(C(N)=O)CO1.
What is the InChIKey of 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide?
The InChIKey is JEQOHEICBWFMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-6(12)8(2)14-4-9(3-10,5-15-8)7(11)13/h4-5H2,1-2H3,(H2,11,13).
What are the key properties of 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide?
2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide has a molecular weight of 212.20 g/mol, XLogP of -0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-5-cyano-2-methyl-1,3-dioxane-5-carboxamide is sourced from PubChem (CID 70992054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).