C31H45NO6S — CID 70992104
2-[ethyl(2-methoxyethyl)amino]ethyl 5-[3-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate (PubChem CID 70992104) has the molecular formula C31H45NO6S and a molecular weight of 559.77 g/mol. Its IUPAC name is 2-[ethyl(2-methoxyethyl)amino]ethyl 5-[3-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate.
| Compound Name | 2-[ethyl(2-methoxyethyl)amino]ethyl 5-[3-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70992104 |
| Molecular Formula | C31H45NO6S |
| Molecular Weight | 559.77 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 2-[ethyl(2-methoxyethyl)amino]ethyl 5-[3-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]propyl]thiophene-2-carboxylate |
| SMILES | CCN(CCOC)CCOC(=O)c1ccc(CCC[C@@H]2[C@@H](/C=C/[C@@H](O)CCc3ccccc3)[C@H](O)C[C@@H]2O)s1 |
| InChI | InChI=1S/C31H45NO6S/c1-3-32(18-20-37-2)19-21-38-31(36)30-17-15-25(39-30)10-7-11-26-27(29(35)22-28(26)34)16-14-24(33)13-12-23-8-5-4-6-9-23/h4-6,8-9,14-17,24,26-29,33-35H,3,7,10-13,18-22H2,1-2H3/b16-14+/t24-,26+,27+,28-,29+/m0/s1 |
| InChIKey | DXRJBNMLMGULAF-YWZBWDLDSA-N |
| XLogP | 4.10 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|