C20H34O2 — CID 70992287
(1S,2S,3S,4R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one (PubChem CID 70992287) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,2S,3S,4R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one.
| Compound Name | (1S,2S,3S,4R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one |
|---|---|
| PubChem CID | 70992287 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1S,2S,3S,4R,7R)-4-ethyl-3-hydroxy-2,4,7,14-tetramethyltricyclo[5.4.3.01,8]tetradecan-9-one |
| SMILES | CC[C@]1(C)CC[C@]2(C)C(C)CC[C@]3(CCC(=O)C23)[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C20H34O2/c1-6-18(4)11-12-19(5)13(2)7-9-20(14(3)17(18)22)10-8-15(21)16(19)20/h13-14,16-17,22H,6-12H2,1-5H3/t13?,14-,16?,17+,18-,19-,20+/m1/s1 |
| InChIKey | TUWQLRPEYVJKTQ-IPYKBHJESA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |