C22H35N — CID 70992306
7-butyl-N-methyl-8-propyl-4,4a,4b,5,6,7,8,8a-octahydro-3H-phenanthren-2-imine (PubChem CID 70992306) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is 7-butyl-N-methyl-8-propyl-4,4a,4b,5,6,7,8,8a-octahydro-3H-phenanthren-2-imine.
| Compound Name | 7-butyl-N-methyl-8-propyl-4,4a,4b,5,6,7,8,8a-octahydro-3H-phenanthren-2-imine |
|---|---|
| PubChem CID | 70992306 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 7-butyl-N-methyl-8-propyl-4,4a,4b,5,6,7,8,8a-octahydro-3H-phenanthren-2-imine |
| SMILES | CCCCC1CCC2C3CC/C(=N\C)C=C3C=CC2C1CCC |
| InChI | InChI=1S/C22H35N/c1-4-6-8-16-9-12-22-20-14-11-18(23-3)15-17(20)10-13-21(22)19(16)7-5-2/h10,13,15-16,19-22H,4-9,11-12,14H2,1-3H3/b23-18+ |
| InChIKey | UPPXCRXYDMLDQG-PTGBLXJZSA-N |
| XLogP | 6.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|