C16H18F5N5O — CID 70992647
4-N-[3-(1,1-difluoroethyl)phenyl]-2-N-propan-2-yl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 70992647) has the molecular formula C16H18F5N5O and a molecular weight of 391.34 g/mol. Its IUPAC name is 4-N-[3-(1,1-difluoroethyl)phenyl]-2-N-propan-2-yl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[3-(1,1-difluoroethyl)phenyl]-2-N-propan-2-yl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 70992647 |
| Molecular Formula | C16H18F5N5O |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-N-[3-(1,1-difluoroethyl)phenyl]-2-N-propan-2-yl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Nc1nc(Nc2cccc(C(C)(F)F)c2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C16H18F5N5O/c1-9(2)22-12-24-13(26-14(25-12)27-8-16(19,20)21)23-11-6-4-5-10(7-11)15(3,17)18/h4-7,9H,8H2,1-3H3,(H2,22,23,24,25,26) |
| InChIKey | VXZQPXSDDJIYIY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |