C33H44Br2N6O4 — CID 70993023
[(2R)-3-(3,4-dibromophenyl)-1-oxo-1-(4-piperazin-1-ylpiperidin-1-yl)propan-2-yl] 4-(2-oxo-4,5,7,8-tetrahydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate (PubChem CID 70993023) has the molecular formula C33H44Br2N6O4 and a molecular weight of 748.56 g/mol. Its IUPAC name is [(2R)-3-(3,4-dibromophenyl)-1-oxo-1-(4-piperazin-1-ylpiperidin-1-yl)propan-2-yl] 4-(2-oxo-4,5,7,8-tetrahydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate.
| Compound Name | [(2R)-3-(3,4-dibromophenyl)-1-oxo-1-(4-piperazin-1-ylpiperidin-1-yl)propan-2-yl] 4-(2-oxo-4,5,7,8-tetrahydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70993023 |
| Molecular Formula | C33H44Br2N6O4 |
| Molecular Weight | 748.56 g/mol |
| Exact Mass | 746.18 |
| IUPAC Name | [(2R)-3-(3,4-dibromophenyl)-1-oxo-1-(4-piperazin-1-ylpiperidin-1-yl)propan-2-yl] 4-(2-oxo-4,5,7,8-tetrahydro-1H-1,3-benzodiazepin-3-yl)piperidine-1-carboxylate |
| SMILES | O=C(O[C@H](Cc1ccc(Br)c(Br)c1)C(=O)N1CCC(N2CCNCC2)CC1)N1CCC(N2CCC3=CCCC=C3NC2=O)CC1 |
| InChI | InChI=1S/C33H44Br2N6O4/c34-27-6-5-23(21-28(27)35)22-30(31(42)39-14-8-25(9-15-39)38-19-12-36-13-20-38)45-33(44)40-16-10-26(11-17-40)41-18-7-24-3-1-2-4-29(24)37-32(41)43/h3-6,21,25-26,30,36H,1-2,7-20,22H2,(H,37,43)/t30-/m1/s1 |
| InChIKey | VOFTXAYMHBIDQP-SSEXGKCCSA-N |
| XLogP | 4.64 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |