C23H31FN3O3+ — CID 7099307
2-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-ium-1-yl]ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 7099307) has the molecular formula C23H31FN3O3+ and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-ium-1-yl]ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-ium-1-yl]ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 7099307 |
| Molecular Formula | C23H31FN3O3+ |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 2-[2-[4-[2-(4-fluorophenyl)acetyl]piperazin-1-ium-1-yl]ethyliminomethyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(/C=N/CC[NH+]2CCN(C(=O)Cc3ccc(F)cc3)CC2)C(=O)C1 |
| InChI | InChI=1S/C23H30FN3O3/c1-23(2)14-20(28)19(21(29)15-23)16-25-7-8-26-9-11-27(12-10-26)22(30)13-17-3-5-18(24)6-4-17/h3-6,16,19H,7-15H2,1-2H3/p+1/b25-16+ |
| InChIKey | NBPZMHUPPDAVQP-PCLIKHOPSA-O |
| XLogP | 0.74 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|