C28H34N2O3 — CID 70993284
2-(5-methyl-1-tricyclo[3.3.1.13,7]dec-3-enyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide (PubChem CID 70993284) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-(5-methyl-1-tricyclo[3.3.1.13,7]dec-3-enyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide.
| Compound Name | 2-(5-methyl-1-tricyclo[3.3.1.13,7]dec-3-enyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 70993284 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2-(5-methyl-1-tricyclo[3.3.1.13,7]dec-3-enyl)-N-[2-(oxan-4-ylmethyl)-1-oxoisoquinolin-5-yl]acetamide |
| SMILES | CC12C=C3CC(C1)CC(CC(=O)Nc1cccc4c(=O)n(CC5CCOCC5)ccc14)(C3)C2 |
| InChI | InChI=1S/C28H34N2O3/c1-27-12-20-11-21(13-27)15-28(14-20,18-27)16-25(31)29-24-4-2-3-23-22(24)5-8-30(26(23)32)17-19-6-9-33-10-7-19/h2-5,8,12,19,21H,6-7,9-11,13-18H2,1H3,(H,29,31) |
| InChIKey | QUHRCFOAPGKMGE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|