About 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione
2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 7099341) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione |
| PubChem CID | 7099341 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCCCCC/N=C/C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C15H25NO2/c1-4-5-6-7-8-16-11-12-13(17)9-15(2,3)10-14(12)18/h11-12H,4-10H2,1-3H3/b16-11+ |
| InChIKey | OTPVNCPIXYAUPQ-LFIBNONCSA-N |
| XLogP | 3.21 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione?
The IUPAC name of 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione (CID 7099341) is 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione.
What is the SMILES notation for 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione?
The canonical SMILES for 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione is CCCCCC/N=C/C1C(=O)CC(C)(C)CC1=O.
What is the InChIKey of 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione?
The InChIKey is OTPVNCPIXYAUPQ-LFIBNONCSA-N. The full InChI is InChI=1S/C15H25NO2/c1-4-5-6-7-8-16-11-12-13(17)9-15(2,3)10-14(12)18/h11-12H,4-10H2,1-3H3/b16-11+.
What are the key properties of 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione?
2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione has a molecular weight of 251.37 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hexyliminomethyl)-5,5-dimethylcyclohexane-1,3-dione is sourced from PubChem (CID 7099341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).