C28H30F4N8O3 — CID 70993541
4-amino-5-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(3-morpholin-4-ylpropyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 70993541) has the molecular formula C28H30F4N8O3 and a molecular weight of 602.59 g/mol. Its IUPAC name is 4-amino-5-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(3-morpholin-4-ylpropyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-amino-5-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(3-morpholin-4-ylpropyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 70993541 |
| Molecular Formula | C28H30F4N8O3 |
| Molecular Weight | 602.59 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 4-amino-5-[4-[[2-fluoro-5-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(3-morpholin-4-ylpropyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | NC1=NC=NN2CC(C(=O)NCCCN3CCOCC3)C(c3ccc(NC(=O)Nc4cc(C(F)(F)F)ccc4F)cc3)=C12 |
| InChI | InChI=1S/C28H30F4N8O3/c29-21-7-4-18(28(30,31)32)14-22(21)38-27(42)37-19-5-2-17(3-6-19)23-20(15-40-24(23)25(33)35-16-36-40)26(41)34-8-1-9-39-10-12-43-13-11-39/h2-7,14,16,20H,1,8-13,15H2,(H,34,41)(H2,33,35,36)(H2,37,38,42) |
| InChIKey | ZFFQMPXMIGVLGE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|