C23H24N8O3 — CID 70993560
1-[4-[4-amino-6-(1,3-oxazol-5-yl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea (PubChem CID 70993560) has the molecular formula C23H24N8O3 and a molecular weight of 460.50 g/mol. Its IUPAC name is 1-[4-[4-amino-6-(1,3-oxazol-5-yl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea.
| Compound Name | 1-[4-[4-amino-6-(1,3-oxazol-5-yl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 70993560 |
| Molecular Formula | C23H24N8O3 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[4-[4-amino-6-(1,3-oxazol-5-yl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(C3=C4C(N)=NC=NN4CC3c3cnco3)cc2)on1 |
| InChI | InChI=1S/C23H24N8O3/c1-23(2,3)17-8-18(34-30-17)29-22(32)28-14-6-4-13(5-7-14)19-15(16-9-25-12-33-16)10-31-20(19)21(24)26-11-27-31/h4-9,11-12,15H,10H2,1-3H3,(H2,24,26,27)(H2,28,29,32) |
| InChIKey | AXTPVAMLGQQXAP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 147.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |