C22H39NO4 — CID 70993651
(3R,5S)-1-[6-(1-adamantyl)hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 70993651) has the molecular formula C22H39NO4 and a molecular weight of 381.56 g/mol. Its IUPAC name is (3R,5S)-1-[6-(1-adamantyl)hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (3R,5S)-1-[6-(1-adamantyl)hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 70993651 |
| Molecular Formula | C22H39NO4 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | (3R,5S)-1-[6-(1-adamantyl)hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OCC1[C@@H](O)C(O)[C@@H](O)CN1CCCCCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H39NO4/c24-14-18-20(26)21(27)19(25)13-23(18)6-4-2-1-3-5-22-10-15-7-16(11-22)9-17(8-15)12-22/h15-21,24-27H,1-14H2/t15?,16?,17?,18?,19-,20+,21?,22?/m0/s1 |
| InChIKey | ZIOJXWDAAUVOFR-UJXQSFGESA-N |
| XLogP | 1.91 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|