C25H44N2 — CID 70993795
1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methyl-2-N-[(4-propan-2-ylcyclohex-3-en-1-yl)methyl]pentane-1,2-diamine (PubChem CID 70993795) has the molecular formula C25H44N2 and a molecular weight of 372.64 g/mol. Its IUPAC name is 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methyl-2-N-[(4-propan-2-ylcyclohex-3-en-1-yl)methyl]pentane-1,2-diamine.
| Compound Name | 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methyl-2-N-[(4-propan-2-ylcyclohex-3-en-1-yl)methyl]pentane-1,2-diamine |
|---|---|
| PubChem CID | 70993795 |
| Molecular Formula | C25H44N2 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 372.35 |
| IUPAC Name | 1-N-(3-cyclohexa-1,3-dien-1-ylpropyl)-4-methyl-2-N-[(4-propan-2-ylcyclohex-3-en-1-yl)methyl]pentane-1,2-diamine |
| SMILES | CC(C)CC(CNCCCC1=CC=CCC1)NCC1CC=C(C(C)C)CC1 |
| InChI | InChI=1S/C25H44N2/c1-20(2)17-25(19-26-16-8-11-22-9-6-5-7-10-22)27-18-23-12-14-24(15-13-23)21(3)4/h5-6,9,14,20-21,23,25-27H,7-8,10-13,15-19H2,1-4H3 |
| InChIKey | UVIMSUCONAHIMC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|