About (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine]
(3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] (PubChem CID 70993859) has the molecular formula C12H15ClN2
and a molecular weight of 222.72 g/mol. Its IUPAC name is (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine].
Molecular Properties
| Compound Name | (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] |
| PubChem CID | 70993859 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] |
| SMILES | CN1CC[C@@]2(CNc3ccc(Cl)cc32)C1 |
| InChI | InChI=1S/C12H15ClN2/c1-15-5-4-12(8-15)7-14-11-3-2-9(13)6-10(11)12/h2-3,6,14H,4-5,7-8H2,1H3/t12-/m1/s1 |
| InChIKey | GLFIJRADPBLAFH-GFCCVEGCSA-N |
| XLogP | 2.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine]?
The IUPAC name of (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] (CID 70993859) is (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine].
What is the SMILES notation for (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine]?
The canonical SMILES for (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] is CN1CC[C@@]2(CNc3ccc(Cl)cc32)C1.
What is the InChIKey of (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine]?
The InChIKey is GLFIJRADPBLAFH-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H15ClN2/c1-15-5-4-12(8-15)7-14-11-3-2-9(13)6-10(11)12/h2-3,6,14H,4-5,7-8H2,1H3/t12-/m1/s1.
What are the key properties of (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine]?
(3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] has a molecular weight of 222.72 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-chloro-1'-methylspiro[1,2-dihydroindole-3,3'-pyrrolidine] is sourced from PubChem (CID 70993859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).