C27H30O9 — CID 70993959
2,4,6,8-tetramethoxy-5-(2,4,6-trimethoxyphenyl)-5H-benzo[d][1,3]benzodioxocine (PubChem CID 70993959) has the molecular formula C27H30O9 and a molecular weight of 498.53 g/mol. Its IUPAC name is 2,4,6,8-tetramethoxy-5-(2,4,6-trimethoxyphenyl)-5H-benzo[d][1,3]benzodioxocine.
| Compound Name | 2,4,6,8-tetramethoxy-5-(2,4,6-trimethoxyphenyl)-5H-benzo[d][1,3]benzodioxocine |
|---|---|
| PubChem CID | 70993959 |
| Molecular Formula | C27H30O9 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2,4,6,8-tetramethoxy-5-(2,4,6-trimethoxyphenyl)-5H-benzo[d][1,3]benzodioxocine |
| SMILES | COc1cc(OC)c(C2c3c(OC)cc(OC)cc3OCOc3cc(OC)cc(OC)c32)c(OC)c1 |
| InChI | InChI=1S/C27H30O9/c1-28-15-8-18(31-4)24(19(9-15)32-5)27-25-20(33-6)10-16(29-2)12-22(25)35-14-36-23-13-17(30-3)11-21(34-7)26(23)27/h8-13,27H,14H2,1-7H3 |
| InChIKey | QJHNRBAZWLZBLA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |