C18H21I — CID 70994227
5-cyclohexa-1,3-dien-1-yl-3-cyclohex-2-en-1-yl-1-iodocyclohexa-1,3-diene (PubChem CID 70994227) has the molecular formula C18H21I and a molecular weight of 364.27 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-3-cyclohex-2-en-1-yl-1-iodocyclohexa-1,3-diene.
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-3-cyclohex-2-en-1-yl-1-iodocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70994227 |
| Molecular Formula | C18H21I |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-3-cyclohex-2-en-1-yl-1-iodocyclohexa-1,3-diene |
| SMILES | IC1=CC(C2C=CCCC2)=CC(C2=CC=CCC2)C1 |
| InChI | InChI=1S/C18H21I/c19-18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1,3,5,7,9,11,13,15-16H,2,4,6,8,10,12H2 |
| InChIKey | WUGOGJRCOVUISZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|