C21H29I — CID 70994246
7-[(1R)-4-iodocyclohex-3-en-1-yl]-9,9-dimethyl-1,2,3,4,6,7,8,8a-octahydrofluorene (PubChem CID 70994246) has the molecular formula C21H29I and a molecular weight of 408.37 g/mol. Its IUPAC name is 7-[(1R)-4-iodocyclohex-3-en-1-yl]-9,9-dimethyl-1,2,3,4,6,7,8,8a-octahydrofluorene.
| Compound Name | 7-[(1R)-4-iodocyclohex-3-en-1-yl]-9,9-dimethyl-1,2,3,4,6,7,8,8a-octahydrofluorene |
|---|---|
| PubChem CID | 70994246 |
| Molecular Formula | C21H29I |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 7-[(1R)-4-iodocyclohex-3-en-1-yl]-9,9-dimethyl-1,2,3,4,6,7,8,8a-octahydrofluorene |
| SMILES | CC1(C)C2=C(CCCC2)C2=CCC([C@H]3CC=C(I)CC3)CC21 |
| InChI | InChI=1S/C21H29I/c1-21(2)19-6-4-3-5-17(19)18-12-9-15(13-20(18)21)14-7-10-16(22)11-8-14/h10,12,14-15,20H,3-9,11,13H2,1-2H3/t14-,15?,20?/m0/s1 |
| InChIKey | LUUYWYRBPIYXON-BQTBQCLESA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|