C25H25I — CID 70994381
2-[(8aR)-4-iodo-1,7,8,8a-tetrahydronaphthalen-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene (PubChem CID 70994381) has the molecular formula C25H25I and a molecular weight of 452.38 g/mol. Its IUPAC name is 2-[(8aR)-4-iodo-1,7,8,8a-tetrahydronaphthalen-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene.
| Compound Name | 2-[(8aR)-4-iodo-1,7,8,8a-tetrahydronaphthalen-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene |
|---|---|
| PubChem CID | 70994381 |
| Molecular Formula | C25H25I |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 2-[(8aR)-4-iodo-1,7,8,8a-tetrahydronaphthalen-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene |
| SMILES | CC1(C)c2ccccc2C2=CC=C(C3C=CC(I)=C4C=CCC[C@@H]43)CC21 |
| InChI | InChI=1S/C25H25I/c1-25(2)22-10-6-5-8-19(22)20-12-11-16(15-23(20)25)17-13-14-24(26)21-9-4-3-7-18(17)21/h4-6,8-14,17-18,23H,3,7,15H2,1-2H3/t17?,18-,23?/m1/s1 |
| InChIKey | SQKZFGIBWJAPMI-FRIYVGAWSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|