C21H21I — CID 70994385
7-iodo-9,9-dimethyl-2-phenyl-1,2,8,8a-tetrahydrofluorene (PubChem CID 70994385) has the molecular formula C21H21I and a molecular weight of 400.30 g/mol. Its IUPAC name is 7-iodo-9,9-dimethyl-2-phenyl-1,2,8,8a-tetrahydrofluorene.
| Compound Name | 7-iodo-9,9-dimethyl-2-phenyl-1,2,8,8a-tetrahydrofluorene |
|---|---|
| PubChem CID | 70994385 |
| Molecular Formula | C21H21I |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 7-iodo-9,9-dimethyl-2-phenyl-1,2,8,8a-tetrahydrofluorene |
| SMILES | CC1(C)C2=C(C=CC(c3ccccc3)C2)C2=CC=C(I)CC21 |
| InChI | InChI=1S/C21H21I/c1-21(2)19-12-15(14-6-4-3-5-7-14)8-10-17(19)18-11-9-16(22)13-20(18)21/h3-11,15,20H,12-13H2,1-2H3 |
| InChIKey | ZQTYLAADQAFIRM-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|