C12H24N6O — CID 70994622
5-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 70994622) has the molecular formula C12H24N6O and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 70994622 |
| Molecular Formula | C12H24N6O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 5-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | CCCCNc1nc(N)nc(NCCCCCO)n1 |
| InChI | InChI=1S/C12H24N6O/c1-2-3-7-14-11-16-10(13)17-12(18-11)15-8-5-4-6-9-19/h19H,2-9H2,1H3,(H4,13,14,15,16,17,18) |
| InChIKey | KXBATEOYECCHTQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|