C32H35BrN2O5 — CID 70994967
(2R,5S,6R)-2-[(2R,3S)-2-(4-bromo-2-butoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one (PubChem CID 70994967) has the molecular formula C32H35BrN2O5 and a molecular weight of 607.55 g/mol. Its IUPAC name is (2R,5S,6R)-2-[(2R,3S)-2-(4-bromo-2-butoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one.
| Compound Name | (2R,5S,6R)-2-[(2R,3S)-2-(4-bromo-2-butoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one |
|---|---|
| PubChem CID | 70994967 |
| Molecular Formula | C32H35BrN2O5 |
| Molecular Weight | 607.55 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | (2R,5S,6R)-2-[(2R,3S)-2-(4-bromo-2-butoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]oxy-2,4,5-trimethyl-6-phenylmorpholin-3-one |
| SMILES | CCCCOc1cc(Br)ccc1[C@@H]1[C@H](O[C@@]2(C)O[C@H](c3ccccc3)[C@H](C)N(C)C2=O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C32H35BrN2O5/c1-5-6-19-38-26-20-23(33)17-18-25(26)27-29(30(36)35(27)24-15-11-8-12-16-24)40-32(3)31(37)34(4)21(2)28(39-32)22-13-9-7-10-14-22/h7-18,20-21,27-29H,5-6,19H2,1-4H3/t21-,27+,28-,29-,32+/m0/s1 |
| InChIKey | ZQRKWLFYZNHDHX-FJBVBXNRSA-N |
| XLogP | 6.44 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|