C26H30N2O7 — CID 70995033
(3R,4R)-1-[(2R)-2-(2-butoxy-4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-3,4-dimethoxypyrrolidine-2,5-dione (PubChem CID 70995033) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is (3R,4R)-1-[(2R)-2-(2-butoxy-4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-3,4-dimethoxypyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-1-[(2R)-2-(2-butoxy-4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-3,4-dimethoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70995033 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (3R,4R)-1-[(2R)-2-(2-butoxy-4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-3,4-dimethoxypyrrolidine-2,5-dione |
| SMILES | CCCCOc1cc(OC)ccc1[C@@H]1C(N2C(=O)[C@H](OC)[C@@H](OC)C2=O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C26H30N2O7/c1-5-6-14-35-19-15-17(32-2)12-13-18(19)20-21(24(29)27(20)16-10-8-7-9-11-16)28-25(30)22(33-3)23(34-4)26(28)31/h7-13,15,20-23H,5-6,14H2,1-4H3/t20-,21?,22-,23-/m1/s1 |
| InChIKey | HYWPDXIIIOKOHT-LFSXGSMDSA-N |
| XLogP | 2.73 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|