C34H31FN2O4 — CID 70995036
(4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-phenylimidazolidin-2-one (PubChem CID 70995036) has the molecular formula C34H31FN2O4 and a molecular weight of 550.63 g/mol. Its IUPAC name is (4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-phenylimidazolidin-2-one.
| Compound Name | (4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-phenylimidazolidin-2-one |
|---|---|
| PubChem CID | 70995036 |
| Molecular Formula | C34H31FN2O4 |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (4S,5R)-5-[2-butoxy-4-(3-hydroxyphenyl)phenyl]-4-[(E)-3-(4-fluorophenyl)-3-oxoprop-1-enyl]-1-phenylimidazolidin-2-one |
| SMILES | CCCCOc1cc(-c2cccc(O)c2)ccc1[C@@H]1[C@H](/C=C/C(=O)c2ccc(F)cc2)NC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C34H31FN2O4/c1-2-3-20-41-32-22-25(24-8-7-11-28(38)21-24)14-17-29(32)33-30(18-19-31(39)23-12-15-26(35)16-13-23)36-34(40)37(33)27-9-5-4-6-10-27/h4-19,21-22,30,33,38H,2-3,20H2,1H3,(H,36,40)/b19-18+/t30-,33+/m0/s1 |
| InChIKey | NTYLDANMJPMFFE-HEYUMIIDSA-N |
| XLogP | 7.46 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|