About 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine
6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine (PubChem CID 70995135) has the molecular formula C9H16N6
and a molecular weight of 208.27 g/mol. Its IUPAC name is 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine.
Molecular Properties
| Compound Name | 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine |
| PubChem CID | 70995135 |
| Molecular Formula | C9H16N6 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine |
| SMILES | Cc1nnc(N2CCN(C)CC2)nc1N |
| InChI | InChI=1S/C9H16N6/c1-7-8(10)11-9(13-12-7)15-5-3-14(2)4-6-15/h3-6H2,1-2H3,(H2,10,11,13) |
| InChIKey | DBMKYYNYCRLPOK-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine?
The IUPAC name of 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine (CID 70995135) is 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine.
What is the SMILES notation for 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine?
The canonical SMILES for 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine is Cc1nnc(N2CCN(C)CC2)nc1N.
What is the InChIKey of 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine?
The InChIKey is DBMKYYNYCRLPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N6/c1-7-8(10)11-9(13-12-7)15-5-3-14(2)4-6-15/h3-6H2,1-2H3,(H2,10,11,13).
What are the key properties of 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine?
6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine has a molecular weight of 208.27 g/mol, XLogP of -0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-(4-methylpiperazin-1-yl)-1,2,4-triazin-5-amine is sourced from PubChem (CID 70995135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).