C30H40N2O3S — CID 70995377
5-[(4R)-6-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]-4-ethyl-4-hydroxy-3-methyl-5-oxohexyl]-4a,6-dimethyl-5,6,7,8-tetrahydronaphthalen-2-one (PubChem CID 70995377) has the molecular formula C30H40N2O3S and a molecular weight of 508.73 g/mol. Its IUPAC name is 5-[(4R)-6-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]-4-ethyl-4-hydroxy-3-methyl-5-oxohexyl]-4a,6-dimethyl-5,6,7,8-tetrahydronaphthalen-2-one.
| Compound Name | 5-[(4R)-6-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]-4-ethyl-4-hydroxy-3-methyl-5-oxohexyl]-4a,6-dimethyl-5,6,7,8-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 70995377 |
| Molecular Formula | C30H40N2O3S |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 5-[(4R)-6-[(5,6-dimethyl-1H-benzimidazol-2-yl)sulfanyl]-4-ethyl-4-hydroxy-3-methyl-5-oxohexyl]-4a,6-dimethyl-5,6,7,8-tetrahydronaphthalen-2-one |
| SMILES | CC[C@](O)(C(=O)CSc1nc2cc(C)c(C)cc2[nH]1)C(C)CCC1C(C)CCC2=CC(=O)C=CC21C |
| InChI | InChI=1S/C30H40N2O3S/c1-7-30(35,27(34)17-36-28-31-25-14-19(3)20(4)15-26(25)32-28)21(5)9-11-24-18(2)8-10-22-16-23(33)12-13-29(22,24)6/h12-16,18,21,24,35H,7-11,17H2,1-6H3,(H,31,32)/t18?,21?,24?,29?,30-/m1/s1 |
| InChIKey | YOOSSZHYEZHTHR-UFHJVXBLSA-N |
| XLogP | 6.52 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |