C27H36F2O5 — CID 70995399
(5,5-difluoro-6-hydroxy-3',6-dimethylspiro[1,3-dioxane-4,6'-bicyclo[3.3.1]nonane]-3'-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 70995399) has the molecular formula C27H36F2O5 and a molecular weight of 478.58 g/mol. Its IUPAC name is (5,5-difluoro-6-hydroxy-3',6-dimethylspiro[1,3-dioxane-4,6'-bicyclo[3.3.1]nonane]-3'-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | (5,5-difluoro-6-hydroxy-3',6-dimethylspiro[1,3-dioxane-4,6'-bicyclo[3.3.1]nonane]-3'-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 70995399 |
| Molecular Formula | C27H36F2O5 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | (5,5-difluoro-6-hydroxy-3',6-dimethylspiro[1,3-dioxane-4,6'-bicyclo[3.3.1]nonane]-3'-yl) tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | CC1(OC(=O)C2CC3CC2C2C4C=CC(C4)C32)CC2CCC3(OCOC(C)(O)C3(F)F)C(C2)C1 |
| InChI | InChI=1S/C27H36F2O5/c1-24(34-23(30)20-10-17-9-19(20)22-16-4-3-15(8-16)21(17)22)11-14-5-6-26(18(7-14)12-24)27(28,29)25(2,31)32-13-33-26/h3-4,14-22,31H,5-13H2,1-2H3 |
| InChIKey | MBANQZRMUKSAJM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|